C27H27Cl2N3O2 — CID 69145531
N-[2,3-bis(4-chlorophenyl)butyl]-2-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide (PubChem CID 69145531) has the molecular formula C27H27Cl2N3O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-2-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-2-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 69145531 |
| Molecular Formula | C27H27Cl2N3O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-2-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNC(=O)Cc1ccc(N2CCNC2=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H27Cl2N3O2/c1-18(20-4-8-22(28)9-5-20)25(21-6-10-23(29)11-7-21)17-31-26(33)16-19-2-12-24(13-3-19)32-15-14-30-27(32)34/h2-13,18,25H,14-17H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | GBQAIDOAKUFHSN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |