C26H25Cl2N3O2 — CID 69375843
N-[2,3-bis(4-chlorophenyl)butyl]-3-(2-oxoimidazolidin-1-yl)benzamide (PubChem CID 69375843) has the molecular formula C26H25Cl2N3O2 and a molecular weight of 482.41 g/mol. Its IUPAC name is N-[2,3-bis(4-chlorophenyl)butyl]-3-(2-oxoimidazolidin-1-yl)benzamide.
| Compound Name | N-[2,3-bis(4-chlorophenyl)butyl]-3-(2-oxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 69375843 |
| Molecular Formula | C26H25Cl2N3O2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[2,3-bis(4-chlorophenyl)butyl]-3-(2-oxoimidazolidin-1-yl)benzamide |
| SMILES | CC(c1ccc(Cl)cc1)C(CNC(=O)c1cccc(N2CCNC2=O)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O2/c1-17(18-5-9-21(27)10-6-18)24(19-7-11-22(28)12-8-19)16-30-25(32)20-3-2-4-23(15-20)31-14-13-29-26(31)33/h2-12,15,17,24H,13-14,16H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | RMNYVUQEIBCNBN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |