C13H15N3O4 — CID 119350110
2-[[3-(2-oxo-1,3-diazinan-1-yl)benzoyl]amino]acetic acid (PubChem CID 119350110) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[[3-(2-oxo-1,3-diazinan-1-yl)benzoyl]amino]acetic acid.
| Compound Name | 2-[[3-(2-oxo-1,3-diazinan-1-yl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 119350110 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[[3-(2-oxo-1,3-diazinan-1-yl)benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cccc(N2CCCNC2=O)c1 |
| InChI | InChI=1S/C13H15N3O4/c17-11(18)8-15-12(19)9-3-1-4-10(7-9)16-6-2-5-14-13(16)20/h1,3-4,7H,2,5-6,8H2,(H,14,20)(H,15,19)(H,17,18) |
| InChIKey | JNPUMYOHXHMMCT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |