C20H21N3O4 — CID 119367069
(2R)-2-[[3-(2-oxo-1,3-diazinan-1-yl)benzoyl]amino]-3-phenylpropanoic acid (PubChem CID 119367069) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (2R)-2-[[3-(2-oxo-1,3-diazinan-1-yl)benzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[3-(2-oxo-1,3-diazinan-1-yl)benzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119367069 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (2R)-2-[[3-(2-oxo-1,3-diazinan-1-yl)benzoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)c1cccc(N2CCCNC2=O)c1 |
| InChI | InChI=1S/C20H21N3O4/c24-18(22-17(19(25)26)12-14-6-2-1-3-7-14)15-8-4-9-16(13-15)23-11-5-10-21-20(23)27/h1-4,6-9,13,17H,5,10-12H2,(H,21,27)(H,22,24)(H,25,26)/t17-/m1/s1 |
| InChIKey | JVAPXKYIQWLZHH-QGZVFWFLSA-N |
| XLogP | 2.03 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |