C16H22N4O2 — CID 119514860
3-(2-oxo-1,3-diazinan-1-yl)-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 119514860) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-(2-oxo-1,3-diazinan-1-yl)-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 3-(2-oxo-1,3-diazinan-1-yl)-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119514860 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-(2-oxo-1,3-diazinan-1-yl)-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCN1)c1cccc(N2CCCNC2=O)c1 |
| InChI | InChI=1S/C16H22N4O2/c21-15(19-11-13-5-2-7-17-13)12-4-1-6-14(10-12)20-9-3-8-18-16(20)22/h1,4,6,10,13,17H,2-3,5,7-9,11H2,(H,18,22)(H,19,21) |
| InChIKey | NDCSHSKRUINYCF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |