C18H17ClN4O3S — CID 55787522
N'-[2-(4-chlorophenyl)sulfanylacetyl]-3-(2-oxoimidazolidin-1-yl)benzohydrazide (PubChem CID 55787522) has the molecular formula C18H17ClN4O3S and a molecular weight of 404.88 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylacetyl]-3-(2-oxoimidazolidin-1-yl)benzohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-3-(2-oxoimidazolidin-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 55787522 |
| Molecular Formula | C18H17ClN4O3S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-3-(2-oxoimidazolidin-1-yl)benzohydrazide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=O)c1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C18H17ClN4O3S/c19-13-4-6-15(7-5-13)27-11-16(24)21-22-17(25)12-2-1-3-14(10-12)23-9-8-20-18(23)26/h1-7,10H,8-9,11H2,(H,20,26)(H,21,24)(H,22,25) |
| InChIKey | FQKGQLPJSQJLEV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|