C16H13F2N3O2 — CID 110874016
3,4-difluoro-N-[3-(2-oxoimidazolidin-1-yl)phenyl]benzamide (PubChem CID 110874016) has the molecular formula C16H13F2N3O2 and a molecular weight of 317.30 g/mol. Its IUPAC name is 3,4-difluoro-N-[3-(2-oxoimidazolidin-1-yl)phenyl]benzamide.
| Compound Name | 3,4-difluoro-N-[3-(2-oxoimidazolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 110874016 |
| Molecular Formula | C16H13F2N3O2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 3,4-difluoro-N-[3-(2-oxoimidazolidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(N2CCNC2=O)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F2N3O2/c17-13-5-4-10(8-14(13)18)15(22)20-11-2-1-3-12(9-11)21-7-6-19-16(21)23/h1-5,8-9H,6-7H2,(H,19,23)(H,20,22) |
| InChIKey | ORRGJBLFXRVERN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |