C17H16F2N4O3 — CID 55831507
1-[3-(difluoromethoxy)phenyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea (PubChem CID 55831507) has the molecular formula C17H16F2N4O3 and a molecular weight of 362.34 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 55831507 |
| Molecular Formula | C17H16F2N4O3 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)Nc1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C17H16F2N4O3/c18-15(19)26-14-6-2-4-12(10-14)22-16(24)21-11-3-1-5-13(9-11)23-8-7-20-17(23)25/h1-6,9-10,15H,7-8H2,(H,20,25)(H2,21,22,24) |
| InChIKey | IWJXGQUZGOYOPP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |