C18H19FN4O3 — CID 55738407
1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea (PubChem CID 55738407) has the molecular formula C18H19FN4O3 and a molecular weight of 358.37 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 55738407 |
| Molecular Formula | C18H19FN4O3 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[3-(2-oxoimidazolidin-1-yl)phenyl]urea |
| SMILES | O=C(NCC(O)c1ccc(F)cc1)Nc1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C18H19FN4O3/c19-13-6-4-12(5-7-13)16(24)11-21-17(25)22-14-2-1-3-15(10-14)23-9-8-20-18(23)26/h1-7,10,16,24H,8-9,11H2,(H,20,26)(H2,21,22,25) |
| InChIKey | POVRHRRMFQFFCC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |