C15H16FN3O2 — CID 61030478
1-[2-(4-aminophenyl)-2-hydroxyethyl]-3-(3-fluorophenyl)urea (PubChem CID 61030478) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)-2-hydroxyethyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[2-(4-aminophenyl)-2-hydroxyethyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 61030478 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[2-(4-aminophenyl)-2-hydroxyethyl]-3-(3-fluorophenyl)urea |
| SMILES | Nc1ccc(C(O)CNC(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C15H16FN3O2/c16-11-2-1-3-13(8-11)19-15(21)18-9-14(20)10-4-6-12(17)7-5-10/h1-8,14,20H,9,17H2,(H2,18,19,21) |
| InChIKey | CBKZKPDRTMUGHD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|