C15H14F2N2O2 — CID 94809233
1-(3-fluorophenyl)-3-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 94809233) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 94809233 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | O=C(NC[C@H](O)c1ccccc1F)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H14F2N2O2/c16-10-4-3-5-11(8-10)19-15(21)18-9-14(20)12-6-1-2-7-13(12)17/h1-8,14,20H,9H2,(H2,18,19,21)/t14-/m0/s1 |
| InChIKey | BHZMGBHWKQSXRI-AWEZNQCLSA-N |
| XLogP | 2.82 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |