C16H15FN2O4 — CID 52580627
1-(1,3-benzodioxol-5-yl)-3-[(2S)-2-(2-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 52580627) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[(2S)-2-(2-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[(2S)-2-(2-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 52580627 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[(2S)-2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | O=C(NC[C@@H](O)c1ccccc1F)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15FN2O4/c17-12-4-2-1-3-11(12)13(20)8-18-16(21)19-10-5-6-14-15(7-10)23-9-22-14/h1-7,13,20H,8-9H2,(H2,18,19,21)/t13-/m1/s1 |
| InChIKey | UHLKBEHDMMVLLS-CYBMUJFWSA-N |
| XLogP | 2.41 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |