C16H15FN2O3 — CID 51290583
1-(1,3-benzodioxol-5-yl)-3-[2-(3-fluorophenyl)ethyl]urea (PubChem CID 51290583) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-(3-fluorophenyl)ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(3-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 51290583 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(3-fluorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1cccc(F)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15FN2O3/c17-12-3-1-2-11(8-12)6-7-18-16(20)19-13-4-5-14-15(9-13)22-10-21-14/h1-5,8-9H,6-7,10H2,(H2,18,19,20) |
| InChIKey | HRZVMLLJKOBHPU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |