C16H16F2N2O2S — CID 71865565
1-(3-fluoro-4-methylsulfinylphenyl)-3-[2-(3-fluorophenyl)ethyl]urea (PubChem CID 71865565) has the molecular formula C16H16F2N2O2S and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylsulfinylphenyl)-3-[2-(3-fluorophenyl)ethyl]urea.
| Compound Name | 1-(3-fluoro-4-methylsulfinylphenyl)-3-[2-(3-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 71865565 |
| Molecular Formula | C16H16F2N2O2S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-(3-fluoro-4-methylsulfinylphenyl)-3-[2-(3-fluorophenyl)ethyl]urea |
| SMILES | CS(=O)c1ccc(NC(=O)NCCc2cccc(F)c2)cc1F |
| InChI | InChI=1S/C16H16F2N2O2S/c1-23(22)15-6-5-13(10-14(15)18)20-16(21)19-8-7-11-3-2-4-12(17)9-11/h2-6,9-10H,7-8H2,1H3,(H2,19,20,21) |
| InChIKey | HFALKLXRWJSCGL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |