C15H16FN3O4S — CID 42958119
1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 42958119) has the molecular formula C15H16FN3O4S and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 42958119 |
| Molecular Formula | C15H16FN3O4S |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NCC(O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C15H16FN3O4S/c16-13-4-2-1-3-12(13)14(20)9-18-15(21)19-10-5-7-11(8-6-10)24(17,22)23/h1-8,14,20H,9H2,(H2,17,22,23)(H2,18,19,21) |
| InChIKey | VXWZPOHALWDPQG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |