C16H19N3O5S — CID 46445537
1-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-3-(4-sulfamoylphenyl)urea (PubChem CID 46445537) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-3-(4-sulfamoylphenyl)urea.
| Compound Name | 1-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-3-(4-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 46445537 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-3-(4-sulfamoylphenyl)urea |
| SMILES | COc1ccccc1C(O)CNC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H19N3O5S/c1-24-15-5-3-2-4-13(15)14(20)10-18-16(21)19-11-6-8-12(9-7-11)25(17,22)23/h2-9,14,20H,10H2,1H3,(H2,17,22,23)(H2,18,19,21) |
| InChIKey | DOERIYVCAAGIEZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |