C16H16Cl2N2O3 — CID 51944301
1-(3,5-dichlorophenyl)-3-[(2S)-2-hydroxy-2-(2-methoxyphenyl)ethyl]urea (PubChem CID 51944301) has the molecular formula C16H16Cl2N2O3 and a molecular weight of 355.22 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[(2S)-2-hydroxy-2-(2-methoxyphenyl)ethyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[(2S)-2-hydroxy-2-(2-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 51944301 |
| Molecular Formula | C16H16Cl2N2O3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[(2S)-2-hydroxy-2-(2-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccccc1[C@H](O)CNC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O3/c1-23-15-5-3-2-4-13(15)14(21)9-19-16(22)20-12-7-10(17)6-11(18)8-12/h2-8,14,21H,9H2,1H3,(H2,19,20,22)/t14-/m1/s1 |
| InChIKey | HOZWTRCCDSNCSB-CQSZACIVSA-N |
| XLogP | 3.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |