C17H17F3N2O4 — CID 47033484
1-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-3-[3-(trifluoromethoxy)phenyl]urea (PubChem CID 47033484) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-3-[3-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-3-[3-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 47033484 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[2-hydroxy-2-(2-methoxyphenyl)ethyl]-3-[3-(trifluoromethoxy)phenyl]urea |
| SMILES | COc1ccccc1C(O)CNC(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O4/c1-25-15-8-3-2-7-13(15)14(23)10-21-16(24)22-11-5-4-6-12(9-11)26-17(18,19)20/h2-9,14,23H,10H2,1H3,(H2,21,22,24) |
| InChIKey | RAQLVKMHQOECJR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |