C16H14ClFN2O3 — CID 110893729
N'-(4-chlorophenyl)-N-[2-(2-fluorophenyl)-2-hydroxyethyl]oxamide (PubChem CID 110893729) has the molecular formula C16H14ClFN2O3 and a molecular weight of 336.75 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N-[2-(2-fluorophenyl)-2-hydroxyethyl]oxamide.
| Compound Name | N'-(4-chlorophenyl)-N-[2-(2-fluorophenyl)-2-hydroxyethyl]oxamide |
|---|---|
| PubChem CID | 110893729 |
| Molecular Formula | C16H14ClFN2O3 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N'-(4-chlorophenyl)-N-[2-(2-fluorophenyl)-2-hydroxyethyl]oxamide |
| SMILES | O=C(NCC(O)c1ccccc1F)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClFN2O3/c17-10-5-7-11(8-6-10)20-16(23)15(22)19-9-14(21)12-3-1-2-4-13(12)18/h1-8,14,21H,9H2,(H,19,22)(H,20,23) |
| InChIKey | PGBKSLMGEOJMKH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|