C15H13ClF2N2O2 — CID 75876611
1-(4-chloro-2-fluorophenyl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 75876611) has the molecular formula C15H13ClF2N2O2 and a molecular weight of 326.73 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 75876611 |
| Molecular Formula | C15H13ClF2N2O2 |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccccc1F)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H13ClF2N2O2/c16-9-5-6-13(12(18)7-9)20-15(22)19-8-14(21)10-3-1-2-4-11(10)17/h1-7,14,21H,8H2,(H2,19,20,22) |
| InChIKey | UKOVGVNNTXXTIQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |