C18H19ClFNO2 — CID 109478347
3-(3-chlorophenyl)-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-methylpropanamide (PubChem CID 109478347) has the molecular formula C18H19ClFNO2 and a molecular weight of 335.81 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-methylpropanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 109478347 |
| Molecular Formula | C18H19ClFNO2 |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-2-methylpropanamide |
| SMILES | CC(Cc1cccc(Cl)c1)C(=O)NCC(O)c1ccccc1F |
| InChI | InChI=1S/C18H19ClFNO2/c1-12(9-13-5-4-6-14(19)10-13)18(23)21-11-17(22)15-7-2-3-8-16(15)20/h2-8,10,12,17,22H,9,11H2,1H3,(H,21,23) |
| InChIKey | DXCPDAFIRHFPKY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |