C17H18FN3O3 — CID 51080282
N-[4-[[2-(2-fluorophenyl)-2-hydroxyethyl]carbamoylamino]phenyl]acetamide (PubChem CID 51080282) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[4-[[2-(2-fluorophenyl)-2-hydroxyethyl]carbamoylamino]phenyl]acetamide.
| Compound Name | N-[4-[[2-(2-fluorophenyl)-2-hydroxyethyl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 51080282 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[4-[[2-(2-fluorophenyl)-2-hydroxyethyl]carbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)NCC(O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C17H18FN3O3/c1-11(22)20-12-6-8-13(9-7-12)21-17(24)19-10-16(23)14-4-2-3-5-15(14)18/h2-9,16,23H,10H2,1H3,(H,20,22)(H2,19,21,24) |
| InChIKey | CVIZBSDFCIFYLJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |