C22H26FN3O3 — CID 60545716
1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[4-(4-methylpiperidine-1-carbonyl)phenyl]urea (PubChem CID 60545716) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[4-(4-methylpiperidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[4-(4-methylpiperidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 60545716 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-[4-(4-methylpiperidine-1-carbonyl)phenyl]urea |
| SMILES | CC1CCN(C(=O)c2ccc(NC(=O)NCC(O)c3ccccc3F)cc2)CC1 |
| InChI | InChI=1S/C22H26FN3O3/c1-15-10-12-26(13-11-15)21(28)16-6-8-17(9-7-16)25-22(29)24-14-20(27)18-4-2-3-5-19(18)23/h2-9,15,20,27H,10-14H2,1H3,(H2,24,25,29) |
| InChIKey | UVQUYCSSOPZGDU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |