C17H15FN2O2 — CID 75877588
1-(3-ethynylphenyl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 75877588) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is 1-(3-ethynylphenyl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-(3-ethynylphenyl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 75877588 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(3-ethynylphenyl)-3-[2-(2-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | C#Cc1cccc(NC(=O)NCC(O)c2ccccc2F)c1 |
| InChI | InChI=1S/C17H15FN2O2/c1-2-12-6-5-7-13(10-12)20-17(22)19-11-16(21)14-8-3-4-9-15(14)18/h1,3-10,16,21H,11H2,(H2,19,20,22) |
| InChIKey | YCBOMKQJWCNQNI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|