C16H13F2N3O2 — CID 111450124
1-(3-cyanophenyl)-3-[2-(2,6-difluorophenyl)-2-hydroxyethyl]urea (PubChem CID 111450124) has the molecular formula C16H13F2N3O2 and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[2-(2,6-difluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[2-(2,6-difluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 111450124 |
| Molecular Formula | C16H13F2N3O2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[2-(2,6-difluorophenyl)-2-hydroxyethyl]urea |
| SMILES | N#Cc1cccc(NC(=O)NCC(O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C16H13F2N3O2/c17-12-5-2-6-13(18)15(12)14(22)9-20-16(23)21-11-4-1-3-10(7-11)8-19/h1-7,14,22H,9H2,(H2,20,21,23) |
| InChIKey | SAYHFGXMFDPQAO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |