C16H14FN3O2 — CID 47070336
1-(3-cyanophenyl)-3-[[3-fluoro-4-(hydroxymethyl)phenyl]methyl]urea (PubChem CID 47070336) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[[3-fluoro-4-(hydroxymethyl)phenyl]methyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[[3-fluoro-4-(hydroxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 47070336 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[[3-fluoro-4-(hydroxymethyl)phenyl]methyl]urea |
| SMILES | N#Cc1cccc(NC(=O)NCc2ccc(CO)c(F)c2)c1 |
| InChI | InChI=1S/C16H14FN3O2/c17-15-7-12(4-5-13(15)10-21)9-19-16(22)20-14-3-1-2-11(6-14)8-18/h1-7,21H,9-10H2,(H2,19,20,22) |
| InChIKey | DZTFGJCYGTZKAY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |