C15H12Br2N4O — CID 166333802
1-[(2-amino-3,5-dibromophenyl)methyl]-3-(3-cyanophenyl)urea (PubChem CID 166333802) has the molecular formula C15H12Br2N4O and a molecular weight of 424.10 g/mol. Its IUPAC name is 1-[(2-amino-3,5-dibromophenyl)methyl]-3-(3-cyanophenyl)urea.
| Compound Name | 1-[(2-amino-3,5-dibromophenyl)methyl]-3-(3-cyanophenyl)urea |
|---|---|
| PubChem CID | 166333802 |
| Molecular Formula | C15H12Br2N4O |
| Molecular Weight | 424.10 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | 1-[(2-amino-3,5-dibromophenyl)methyl]-3-(3-cyanophenyl)urea |
| SMILES | N#Cc1cccc(NC(=O)NCc2cc(Br)cc(Br)c2N)c1 |
| InChI | InChI=1S/C15H12Br2N4O/c16-11-5-10(14(19)13(17)6-11)8-20-15(22)21-12-3-1-2-9(4-12)7-18/h1-6H,8,19H2,(H2,20,21,22) |
| InChIKey | GEBDFKZBHUADPD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|