C19H20ClFN4O3 — CID 55746140
1-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 55746140) has the molecular formula C19H20ClFN4O3 and a molecular weight of 406.85 g/mol. Its IUPAC name is 1-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 55746140 |
| Molecular Formula | C19H20ClFN4O3 |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | O=C1CN(c2ccc(NC(=O)NCC(O)c3ccc(F)cc3)cc2Cl)CCN1 |
| InChI | InChI=1S/C19H20ClFN4O3/c20-15-9-14(5-6-16(15)25-8-7-22-18(27)11-25)24-19(28)23-10-17(26)12-1-3-13(21)4-2-12/h1-6,9,17,26H,7-8,10-11H2,(H,22,27)(H2,23,24,28) |
| InChIKey | SMMBTBRIUIUCOR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|