C18H17BrClN3O2S — CID 55661614
2-(4-bromophenyl)sulfanyl-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]acetamide (PubChem CID 55661614) has the molecular formula C18H17BrClN3O2S and a molecular weight of 454.78 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55661614 |
| Molecular Formula | C18H17BrClN3O2S |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]acetamide |
| SMILES | O=C1CN(c2ccc(NC(=O)CSc3ccc(Br)cc3)cc2Cl)CCN1 |
| InChI | InChI=1S/C18H17BrClN3O2S/c19-12-1-4-14(5-2-12)26-11-18(25)22-13-3-6-16(15(20)9-13)23-8-7-21-17(24)10-23/h1-6,9H,7-8,10-11H2,(H,21,24)(H,22,25) |
| InChIKey | BTADZMOXMVGWMN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|