C15H10BrClN2OS — CID 16527847
2-(4-bromophenyl)sulfanyl-N-(3-chloro-4-cyanophenyl)acetamide (PubChem CID 16527847) has the molecular formula C15H10BrClN2OS and a molecular weight of 381.68 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(3-chloro-4-cyanophenyl)acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(3-chloro-4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 16527847 |
| Molecular Formula | C15H10BrClN2OS |
| Molecular Weight | 381.68 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(3-chloro-4-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)CSc2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C15H10BrClN2OS/c16-11-2-5-13(6-3-11)21-9-15(20)19-12-4-1-10(8-18)14(17)7-12/h1-7H,9H2,(H,19,20) |
| InChIKey | CCBFNOCYJQAKJR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |