C17H11ClN4OS — CID 3518128
N-(3-chloro-4-cyanophenyl)-2-quinazolin-4-ylsulfanylacetamide (PubChem CID 3518128) has the molecular formula C17H11ClN4OS and a molecular weight of 354.82 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-quinazolin-4-ylsulfanylacetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-quinazolin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 3518128 |
| Molecular Formula | C17H11ClN4OS |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-quinazolin-4-ylsulfanylacetamide |
| SMILES | N#Cc1ccc(NC(=O)CSc2ncnc3ccccc23)cc1Cl |
| InChI | InChI=1S/C17H11ClN4OS/c18-14-7-12(6-5-11(14)8-19)22-16(23)9-24-17-13-3-1-2-4-15(13)20-10-21-17/h1-7,10H,9H2,(H,22,23) |
| InChIKey | KRVBWQDIXVOTPD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |