C17H14N4O2S — CID 2409976
4-[(2-quinazolin-4-ylsulfanylacetyl)amino]benzamide (PubChem CID 2409976) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 4-[(2-quinazolin-4-ylsulfanylacetyl)amino]benzamide.
| Compound Name | 4-[(2-quinazolin-4-ylsulfanylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 2409976 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-[(2-quinazolin-4-ylsulfanylacetyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CSc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C17H14N4O2S/c18-16(23)11-5-7-12(8-6-11)21-15(22)9-24-17-13-3-1-2-4-14(13)19-10-20-17/h1-8,10H,9H2,(H2,18,23)(H,21,22) |
| InChIKey | CHZPFVZXNKEBTN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |