C19H17N3OS — CID 2652585
N-(2,3-dihydro-1H-inden-5-yl)-2-quinazolin-4-ylsulfanylacetamide (PubChem CID 2652585) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-quinazolin-4-ylsulfanylacetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-quinazolin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 2652585 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-quinazolin-4-ylsulfanylacetamide |
| SMILES | O=C(CSc1ncnc2ccccc12)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H17N3OS/c23-18(22-15-9-8-13-4-3-5-14(13)10-15)11-24-19-16-6-1-2-7-17(16)20-12-21-19/h1-2,6-10,12H,3-5,11H2,(H,22,23) |
| InChIKey | DXBIRCDZXRRQQP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |