C21H24N4O3S2 — CID 4187636
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-quinazolin-4-ylsulfanylacetamide (PubChem CID 4187636) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-quinazolin-4-ylsulfanylacetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-quinazolin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 4187636 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-quinazolin-4-ylsulfanylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CSc2ncnc3ccccc23)ccc1C |
| InChI | InChI=1S/C21H24N4O3S2/c1-4-25(5-2)30(27,28)19-12-16(11-10-15(19)3)24-20(26)13-29-21-17-8-6-7-9-18(17)22-14-23-21/h6-12,14H,4-5,13H2,1-3H3,(H,24,26) |
| InChIKey | XYCAIERVBZNEME-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |