C22H26N4O3S2 — CID 42968880
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-quinazolin-4-ylsulfanylpropanamide (PubChem CID 42968880) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-quinazolin-4-ylsulfanylpropanamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-quinazolin-4-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 42968880 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-quinazolin-4-ylsulfanylpropanamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C(C)Sc2ncnc3ccccc23)ccc1C |
| InChI | InChI=1S/C22H26N4O3S2/c1-5-26(6-2)31(28,29)20-13-17(12-11-15(20)3)25-21(27)16(4)30-22-18-9-7-8-10-19(18)23-14-24-22/h7-14,16H,5-6H2,1-4H3,(H,25,27) |
| InChIKey | PXSKMHSLRUYZDU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |