C20H25N3O5S — CID 7477382
[(2R)-1-[3-(diethylsulfamoyl)-4-methylanilino]-1-oxopropan-2-yl] pyridine-2-carboxylate (PubChem CID 7477382) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is [(2R)-1-[3-(diethylsulfamoyl)-4-methylanilino]-1-oxopropan-2-yl] pyridine-2-carboxylate.
| Compound Name | [(2R)-1-[3-(diethylsulfamoyl)-4-methylanilino]-1-oxopropan-2-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 7477382 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [(2R)-1-[3-(diethylsulfamoyl)-4-methylanilino]-1-oxopropan-2-yl] pyridine-2-carboxylate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)[C@@H](C)OC(=O)c2ccccn2)ccc1C |
| InChI | InChI=1S/C20H25N3O5S/c1-5-23(6-2)29(26,27)18-13-16(11-10-14(18)3)22-19(24)15(4)28-20(25)17-9-7-8-12-21-17/h7-13,15H,5-6H2,1-4H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | RLCKDWKXTRTPFZ-OAHLLOKOSA-N |
| XLogP | 2.60 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |