C19H20N4OS — CID 2607982
(2R)-N-[4-(dimethylamino)phenyl]-2-quinazolin-4-ylsulfanylpropanamide (PubChem CID 2607982) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is (2R)-N-[4-(dimethylamino)phenyl]-2-quinazolin-4-ylsulfanylpropanamide.
| Compound Name | (2R)-N-[4-(dimethylamino)phenyl]-2-quinazolin-4-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 2607982 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (2R)-N-[4-(dimethylamino)phenyl]-2-quinazolin-4-ylsulfanylpropanamide |
| SMILES | C[C@@H](Sc1ncnc2ccccc12)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H20N4OS/c1-13(18(24)22-14-8-10-15(11-9-14)23(2)3)25-19-16-6-4-5-7-17(16)20-12-21-19/h4-13H,1-3H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | DGMABDKUBBLJQG-CYBMUJFWSA-N |
| XLogP | 3.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|