C13H17N5OS — CID 41036926
(2R)-N-[4-(dimethylamino)phenyl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide (PubChem CID 41036926) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is (2R)-N-[4-(dimethylamino)phenyl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide.
| Compound Name | (2R)-N-[4-(dimethylamino)phenyl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 41036926 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2R)-N-[4-(dimethylamino)phenyl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
| SMILES | C[C@@H](Sc1ncn[nH]1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H17N5OS/c1-9(20-13-14-8-15-17-13)12(19)16-10-4-6-11(7-5-10)18(2)3/h4-9H,1-3H3,(H,16,19)(H,14,15,17)/t9-/m1/s1 |
| InChIKey | VHFVVHIOTVOCSZ-SECBINFHSA-N |
| XLogP | 1.99 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|