C5H8N4O2S — CID 130626422
N-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide (PubChem CID 130626422) has the molecular formula C5H8N4O2S and a molecular weight of 188.21 g/mol. Its IUPAC name is N-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide.
| Compound Name | N-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 130626422 |
| Molecular Formula | C5H8N4O2S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | N-hydroxy-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
| SMILES | CC(Sc1ncn[nH]1)C(=O)NO |
| InChI | InChI=1S/C5H8N4O2S/c1-3(4(10)9-11)12-5-6-2-7-8-5/h2-3,11H,1H3,(H,9,10)(H,6,7,8) |
| InChIKey | PWJVTKGODBKQOA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|