C13H15ClN2O2S — CID 65417290
N-(3-chloro-4-cyanophenyl)-2-(4-hydroxybutan-2-ylsulfanyl)acetamide (PubChem CID 65417290) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(4-hydroxybutan-2-ylsulfanyl)acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(4-hydroxybutan-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 65417290 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(4-hydroxybutan-2-ylsulfanyl)acetamide |
| SMILES | CC(CCO)SCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2O2S/c1-9(4-5-17)19-8-13(18)16-11-3-2-10(7-15)12(14)6-11/h2-3,6,9,17H,4-5,8H2,1H3,(H,16,18) |
| InChIKey | WJOJQAGMQQPPSD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |