C10H9ClN4OS — CID 60641836
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] carbamimidothioate (PubChem CID 60641836) has the molecular formula C10H9ClN4OS and a molecular weight of 268.73 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 60641836 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClN4OS/c11-8-3-7(2-1-6(8)4-12)15-9(16)5-17-10(13)14/h1-3H,5H2,(H3,13,14)(H,15,16) |
| InChIKey | CDAUHLBFKWHHQU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|