C13H14ClN3O3S — CID 60920200
2-amino-4-[2-(3-chloro-4-cyanoanilino)-2-oxoethyl]sulfanylbutanoic acid (PubChem CID 60920200) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 2-amino-4-[2-(3-chloro-4-cyanoanilino)-2-oxoethyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[2-(3-chloro-4-cyanoanilino)-2-oxoethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 60920200 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-amino-4-[2-(3-chloro-4-cyanoanilino)-2-oxoethyl]sulfanylbutanoic acid |
| SMILES | N#Cc1ccc(NC(=O)CSCCC(N)C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H14ClN3O3S/c14-10-5-9(2-1-8(10)6-15)17-12(18)7-21-4-3-11(16)13(19)20/h1-2,5,11H,3-4,7,16H2,(H,17,18)(H,19,20) |
| InChIKey | VPWMZXKENSZFRV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|