C14H11ClN2O2S — CID 112780784
N-(3-chloro-4-cyanophenyl)-2-(furan-2-ylmethylsulfanyl)acetamide (PubChem CID 112780784) has the molecular formula C14H11ClN2O2S and a molecular weight of 306.77 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(furan-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(furan-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 112780784 |
| Molecular Formula | C14H11ClN2O2S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(furan-2-ylmethylsulfanyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)CSCc2ccco2)cc1Cl |
| InChI | InChI=1S/C14H11ClN2O2S/c15-13-6-11(4-3-10(13)7-16)17-14(18)9-20-8-12-2-1-5-19-12/h1-6H,8-9H2,(H,17,18) |
| InChIKey | VEZXWQQRAFFNRK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |