C16H13ClN4O4 — CID 55751321
N'-(3-chloro-4-cyanophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]oxamide (PubChem CID 55751321) has the molecular formula C16H13ClN4O4 and a molecular weight of 360.76 g/mol. Its IUPAC name is N'-(3-chloro-4-cyanophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]oxamide.
| Compound Name | N'-(3-chloro-4-cyanophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]oxamide |
|---|---|
| PubChem CID | 55751321 |
| Molecular Formula | C16H13ClN4O4 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N'-(3-chloro-4-cyanophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]oxamide |
| SMILES | N#Cc1ccc(NC(=O)C(=O)NCC(=O)NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C16H13ClN4O4/c17-13-6-11(4-3-10(13)7-18)21-16(24)15(23)20-9-14(22)19-8-12-2-1-5-25-12/h1-6H,8-9H2,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | PHQJQORFOLVJJN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|