C9H10N2O2S — CID 56794182
N-(cyanomethyl)-2-(furan-2-ylmethylsulfanyl)acetamide (PubChem CID 56794182) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(furan-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-(cyanomethyl)-2-(furan-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 56794182 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | N-(cyanomethyl)-2-(furan-2-ylmethylsulfanyl)acetamide |
| SMILES | N#CCNC(=O)CSCc1ccco1 |
| InChI | InChI=1S/C9H10N2O2S/c10-3-4-11-9(12)7-14-6-8-2-1-5-13-8/h1-2,5H,4,6-7H2,(H,11,12) |
| InChIKey | ABBZKTRDRMNDPI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|