C15H15NO4S — CID 112780982
methyl 2-[[2-(furan-2-ylmethylsulfanyl)acetyl]amino]benzoate (PubChem CID 112780982) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is methyl 2-[[2-(furan-2-ylmethylsulfanyl)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(furan-2-ylmethylsulfanyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 112780982 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | methyl 2-[[2-(furan-2-ylmethylsulfanyl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSCc1ccco1 |
| InChI | InChI=1S/C15H15NO4S/c1-19-15(18)12-6-2-3-7-13(12)16-14(17)10-21-9-11-5-4-8-20-11/h2-8H,9-10H2,1H3,(H,16,17) |
| InChIKey | LIJMTYSBFPXEKH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |