C20H17FN2O3S — CID 78812700
N-(4-fluorophenyl)-2-[[2-(furan-2-ylmethylsulfanyl)acetyl]amino]benzamide (PubChem CID 78812700) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[2-(furan-2-ylmethylsulfanyl)acetyl]amino]benzamide.
| Compound Name | N-(4-fluorophenyl)-2-[[2-(furan-2-ylmethylsulfanyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 78812700 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[2-(furan-2-ylmethylsulfanyl)acetyl]amino]benzamide |
| SMILES | O=C(CSCc1ccco1)Nc1ccccc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H17FN2O3S/c21-14-7-9-15(10-8-14)22-20(25)17-5-1-2-6-18(17)23-19(24)13-27-12-16-4-3-11-26-16/h1-11H,12-13H2,(H,22,25)(H,23,24) |
| InChIKey | KQUZOHBIKZJQCU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |