C14H21NO2S — CID 112780967
N-(cyclohexylmethyl)-2-(furan-2-ylmethylsulfanyl)acetamide (PubChem CID 112780967) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-(furan-2-ylmethylsulfanyl)acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-(furan-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 112780967 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-(cyclohexylmethyl)-2-(furan-2-ylmethylsulfanyl)acetamide |
| SMILES | O=C(CSCc1ccco1)NCC1CCCCC1 |
| InChI | InChI=1S/C14H21NO2S/c16-14(11-18-10-13-7-4-8-17-13)15-9-12-5-2-1-3-6-12/h4,7-8,12H,1-3,5-6,9-11H2,(H,15,16) |
| InChIKey | MQOHMLCRYHGYLB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |