C16H22N2O3 — CID 95738938
(2R)-N-(cyclopentylmethyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 95738938) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2R)-N-(cyclopentylmethyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(cyclopentylmethyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95738938 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2R)-N-(cyclopentylmethyl)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1CCCC1)[C@H]1CCC(=O)N1Cc1ccco1 |
| InChI | InChI=1S/C16H22N2O3/c19-15-8-7-14(18(15)11-13-6-3-9-21-13)16(20)17-10-12-4-1-2-5-12/h3,6,9,12,14H,1-2,4-5,7-8,10-11H2,(H,17,20)/t14-/m1/s1 |
| InChIKey | YFRXEWONLSBEAK-CQSZACIVSA-N |
| XLogP | 2.08 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |