C15H20N2O4 — CID 95738982
(2S)-1-(furan-2-ylmethyl)-5-oxo-N-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 95738982) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2S)-1-(furan-2-ylmethyl)-5-oxo-N-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(furan-2-ylmethyl)-5-oxo-N-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95738982 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (2S)-1-(furan-2-ylmethyl)-5-oxo-N-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)[C@@H]1CCC(=O)N1Cc1ccco1 |
| InChI | InChI=1S/C15H20N2O4/c18-14-6-5-13(17(14)10-12-4-2-8-21-12)15(19)16-9-11-3-1-7-20-11/h2,4,8,11,13H,1,3,5-7,9-10H2,(H,16,19)/t11-,13-/m0/s1 |
| InChIKey | PFOOZWWXXUFDKW-AAEUAGOBSA-N |
| XLogP | 1.07 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |